C13H23N5O2 — CID 80946727
ethyl 4-[(6-hydrazinyl-2-propylpyrimidin-4-yl)amino]butanoate (PubChem CID 80946727) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is ethyl 4-[(6-hydrazinyl-2-propylpyrimidin-4-yl)amino]butanoate.
| Compound Name | ethyl 4-[(6-hydrazinyl-2-propylpyrimidin-4-yl)amino]butanoate |
|---|---|
| PubChem CID | 80946727 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | ethyl 4-[(6-hydrazinyl-2-propylpyrimidin-4-yl)amino]butanoate |
| SMILES | CCCc1nc(NN)cc(NCCCC(=O)OCC)n1 |
| InChI | InChI=1S/C13H23N5O2/c1-3-6-10-16-11(9-12(17-10)18-14)15-8-5-7-13(19)20-4-2/h9H,3-8,14H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | OTJFMKKGKBPLHM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|