C10H14FN3O2 — CID 115417070
ethyl 4-[(6-fluoropyrimidin-4-yl)amino]butanoate (PubChem CID 115417070) has the molecular formula C10H14FN3O2 and a molecular weight of 227.24 g/mol. Its IUPAC name is ethyl 4-[(6-fluoropyrimidin-4-yl)amino]butanoate.
| Compound Name | ethyl 4-[(6-fluoropyrimidin-4-yl)amino]butanoate |
|---|---|
| PubChem CID | 115417070 |
| Molecular Formula | C10H14FN3O2 |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | ethyl 4-[(6-fluoropyrimidin-4-yl)amino]butanoate |
| SMILES | CCOC(=O)CCCNc1cc(F)ncn1 |
| InChI | InChI=1S/C10H14FN3O2/c1-2-16-10(15)4-3-5-12-9-6-8(11)13-7-14-9/h6-7H,2-5H2,1H3,(H,12,13,14) |
| InChIKey | PCLNBIHSODAMES-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|