C13H23N3O3 — CID 106257562
1-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 106257562) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 106257562 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | CCOc1cc(NCC(C)(O)CCOC)nc(C)n1 |
| InChI | InChI=1S/C13H23N3O3/c1-5-19-12-8-11(15-10(2)16-12)14-9-13(3,17)6-7-18-4/h8,17H,5-7,9H2,1-4H3,(H,14,15,16) |
| InChIKey | PKJJCTGWBBBXCJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |