C13H17N5 — CID 130209355
4-N-(3-aminopropyl)-6-phenylpyrimidine-2,4-diamine (PubChem CID 130209355) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-N-(3-aminopropyl)-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-aminopropyl)-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 130209355 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 4-N-(3-aminopropyl)-6-phenylpyrimidine-2,4-diamine |
| SMILES | NCCCNc1cc(-c2ccccc2)nc(N)n1 |
| InChI | InChI=1S/C13H17N5/c14-7-4-8-16-12-9-11(17-13(15)18-12)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8,14H2,(H3,15,16,17,18) |
| InChIKey | ICEWHSDOULFSMU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|