C10H11N5 — CID 58316685
4-hydrazinyl-6-phenylpyrimidin-2-amine (PubChem CID 58316685) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 4-hydrazinyl-6-phenylpyrimidin-2-amine.
| Compound Name | 4-hydrazinyl-6-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 58316685 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 4-hydrazinyl-6-phenylpyrimidin-2-amine |
| SMILES | NNc1cc(-c2ccccc2)nc(N)n1 |
| InChI | InChI=1S/C10H11N5/c11-10-13-8(6-9(14-10)15-12)7-4-2-1-3-5-7/h1-6H,12H2,(H3,11,13,14,15) |
| InChIKey | FFDJWRJJMHLCRJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|