C20H27N9 — CID 71681479
6-N-[2-[(2-amino-6-phenylpyrimidin-4-yl)amino]ethyl]-4-N-(2-methylpropyl)pyrimidine-2,4,6-triamine (PubChem CID 71681479) has the molecular formula C20H27N9 and a molecular weight of 393.50 g/mol. Its IUPAC name is 6-N-[2-[(2-amino-6-phenylpyrimidin-4-yl)amino]ethyl]-4-N-(2-methylpropyl)pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-[2-[(2-amino-6-phenylpyrimidin-4-yl)amino]ethyl]-4-N-(2-methylpropyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 71681479 |
| Molecular Formula | C20H27N9 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 6-N-[2-[(2-amino-6-phenylpyrimidin-4-yl)amino]ethyl]-4-N-(2-methylpropyl)pyrimidine-2,4,6-triamine |
| SMILES | CC(C)CNc1cc(NCCNc2cc(-c3ccccc3)nc(N)n2)nc(N)n1 |
| InChI | InChI=1S/C20H27N9/c1-13(2)12-25-18-11-17(28-20(22)29-18)24-9-8-23-16-10-15(26-19(21)27-16)14-6-4-3-5-7-14/h3-7,10-11,13H,8-9,12H2,1-2H3,(H3,21,23,26,27)(H4,22,24,25,28,29) |
| InChIKey | CLXOYYRURNEZQS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 139.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|