C19H23N7 — CID 174852539
4-N-[2-[(6-amino-3-pyridinyl)amino]ethyl]-6-(3,5-dimethylphenyl)pyrimidine-2,4-diamine (PubChem CID 174852539) has the molecular formula C19H23N7 and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-N-[2-[(6-amino-3-pyridinyl)amino]ethyl]-6-(3,5-dimethylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[2-[(6-amino-3-pyridinyl)amino]ethyl]-6-(3,5-dimethylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 174852539 |
| Molecular Formula | C19H23N7 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 4-N-[2-[(6-amino-3-pyridinyl)amino]ethyl]-6-(3,5-dimethylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(C)cc(-c2cc(NCCNc3ccc(N)nc3)nc(N)n2)c1 |
| InChI | InChI=1S/C19H23N7/c1-12-7-13(2)9-14(8-12)16-10-18(26-19(21)25-16)23-6-5-22-15-3-4-17(20)24-11-15/h3-4,7-11,22H,5-6H2,1-2H3,(H2,20,24)(H3,21,23,25,26) |
| InChIKey | LRLHFKJYYHRFQM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|