C22H26N4 — CID 174933873
6-(3,5-dimethylphenyl)-4-N-(4-phenylbutan-2-yl)pyrimidine-2,4-diamine (PubChem CID 174933873) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is 6-(3,5-dimethylphenyl)-4-N-(4-phenylbutan-2-yl)pyrimidine-2,4-diamine.
| Compound Name | 6-(3,5-dimethylphenyl)-4-N-(4-phenylbutan-2-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 174933873 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 6-(3,5-dimethylphenyl)-4-N-(4-phenylbutan-2-yl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(C)cc(-c2cc(NC(C)CCc3ccccc3)nc(N)n2)c1 |
| InChI | InChI=1S/C22H26N4/c1-15-11-16(2)13-19(12-15)20-14-21(26-22(23)25-20)24-17(3)9-10-18-7-5-4-6-8-18/h4-8,11-14,17H,9-10H2,1-3H3,(H3,23,24,25,26) |
| InChIKey | NZGDWBHBVQCUOQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |