C24H30N6 — CID 174775657
6-(3,5-dimethylphenyl)-4-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 174775657) has the molecular formula C24H30N6 and a molecular weight of 402.55 g/mol. Its IUPAC name is 6-(3,5-dimethylphenyl)-4-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 6-(3,5-dimethylphenyl)-4-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 174775657 |
| Molecular Formula | C24H30N6 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 6-(3,5-dimethylphenyl)-4-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cc(C)cc(-c2cc(NCc3ccc(N4CCN(C)CC4)cc3)nc(N)n2)c1 |
| InChI | InChI=1S/C24H30N6/c1-17-12-18(2)14-20(13-17)22-15-23(28-24(25)27-22)26-16-19-4-6-21(7-5-19)30-10-8-29(3)9-11-30/h4-7,12-15H,8-11,16H2,1-3H3,(H3,25,26,27,28) |
| InChIKey | JTWBVBHYPGOAPS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|