C19H26N4 — CID 83962227
3-[[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]methyl]aniline (PubChem CID 83962227) has the molecular formula C19H26N4 and a molecular weight of 310.45 g/mol. Its IUPAC name is 3-[[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]methyl]aniline.
| Compound Name | 3-[[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]methyl]aniline |
|---|---|
| PubChem CID | 83962227 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 3-[[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]methyl]aniline |
| SMILES | CN1CCN(c2ccc(CNCc3cccc(N)c3)cc2)CC1 |
| InChI | InChI=1S/C19H26N4/c1-22-9-11-23(12-10-22)19-7-5-16(6-8-19)14-21-15-17-3-2-4-18(20)13-17/h2-8,13,21H,9-12,14-15,20H2,1H3 |
| InChIKey | LRGLRVHHURODEX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|