C31H36N6 — CID 123504804
2-N-[[3-[2-(benzylamino)anilino]phenyl]methyl]-4-(4-methylpiperazin-1-yl)benzene-1,2-diamine (PubChem CID 123504804) has the molecular formula C31H36N6 and a molecular weight of 492.67 g/mol. Its IUPAC name is 2-N-[[3-[2-(benzylamino)anilino]phenyl]methyl]-4-(4-methylpiperazin-1-yl)benzene-1,2-diamine.
| Compound Name | 2-N-[[3-[2-(benzylamino)anilino]phenyl]methyl]-4-(4-methylpiperazin-1-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 123504804 |
| Molecular Formula | C31H36N6 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | 2-N-[[3-[2-(benzylamino)anilino]phenyl]methyl]-4-(4-methylpiperazin-1-yl)benzene-1,2-diamine |
| SMILES | CN1CCN(c2ccc(N)c(NCc3cccc(Nc4ccccc4NCc4ccccc4)c3)c2)CC1 |
| InChI | InChI=1S/C31H36N6/c1-36-16-18-37(19-17-36)27-14-15-28(32)31(21-27)34-23-25-10-7-11-26(20-25)35-30-13-6-5-12-29(30)33-22-24-8-3-2-4-9-24/h2-15,20-21,33-35H,16-19,22-23,32H2,1H3 |
| InChIKey | JSIVOELPXVPSHL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 68.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|