C24H26N4O2 — CID 150508917
3-amino-4-[3-(4-benzylpiperazin-1-yl)anilino]benzoic acid (PubChem CID 150508917) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-amino-4-[3-(4-benzylpiperazin-1-yl)anilino]benzoic acid.
| Compound Name | 3-amino-4-[3-(4-benzylpiperazin-1-yl)anilino]benzoic acid |
|---|---|
| PubChem CID | 150508917 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 3-amino-4-[3-(4-benzylpiperazin-1-yl)anilino]benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1Nc1cccc(N2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C24H26N4O2/c25-22-15-19(24(29)30)9-10-23(22)26-20-7-4-8-21(16-20)28-13-11-27(12-14-28)17-18-5-2-1-3-6-18/h1-10,15-16,26H,11-14,17,25H2,(H,29,30) |
| InChIKey | HZKOGZYLGRKEOD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|