C24H29N5O5 — CID 90732041
2-methoxyethyl 3-amino-4-[3-[4-[(2-oxo-3H-1,3-oxazol-5-yl)methyl]piperazin-1-yl]anilino]benzoate (PubChem CID 90732041) has the molecular formula C24H29N5O5 and a molecular weight of 467.53 g/mol. Its IUPAC name is 2-methoxyethyl 3-amino-4-[3-[4-[(2-oxo-3H-1,3-oxazol-5-yl)methyl]piperazin-1-yl]anilino]benzoate.
| Compound Name | 2-methoxyethyl 3-amino-4-[3-[4-[(2-oxo-3H-1,3-oxazol-5-yl)methyl]piperazin-1-yl]anilino]benzoate |
|---|---|
| PubChem CID | 90732041 |
| Molecular Formula | C24H29N5O5 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-methoxyethyl 3-amino-4-[3-[4-[(2-oxo-3H-1,3-oxazol-5-yl)methyl]piperazin-1-yl]anilino]benzoate |
| SMILES | COCCOC(=O)c1ccc(Nc2cccc(N3CCN(Cc4c[nH]c(=O)o4)CC3)c2)c(N)c1 |
| InChI | InChI=1S/C24H29N5O5/c1-32-11-12-33-23(30)17-5-6-22(21(25)13-17)27-18-3-2-4-19(14-18)29-9-7-28(8-10-29)16-20-15-26-24(31)34-20/h2-6,13-15,27H,7-12,16,25H2,1H3,(H,26,31) |
| InChIKey | MEVLDFSACISJKP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|