C26H34N4O7 — CID 87417411
2-methoxyethyl 4-[3-[4-(1-butoxy-2-oxoethyl)piperazin-1-yl]anilino]-3-nitrobenzoate (PubChem CID 87417411) has the molecular formula C26H34N4O7 and a molecular weight of 514.58 g/mol. Its IUPAC name is 2-methoxyethyl 4-[3-[4-(1-butoxy-2-oxoethyl)piperazin-1-yl]anilino]-3-nitrobenzoate.
| Compound Name | 2-methoxyethyl 4-[3-[4-(1-butoxy-2-oxoethyl)piperazin-1-yl]anilino]-3-nitrobenzoate |
|---|---|
| PubChem CID | 87417411 |
| Molecular Formula | C26H34N4O7 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 2-methoxyethyl 4-[3-[4-(1-butoxy-2-oxoethyl)piperazin-1-yl]anilino]-3-nitrobenzoate |
| SMILES | CCCCOC(C=O)N1CCN(c2cccc(Nc3ccc(C(=O)OCCOC)cc3[N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C26H34N4O7/c1-3-4-14-36-25(19-31)29-12-10-28(11-13-29)22-7-5-6-21(18-22)27-23-9-8-20(17-24(23)30(33)34)26(32)37-16-15-35-2/h5-9,17-19,25,27H,3-4,10-16H2,1-2H3 |
| InChIKey | QIGAKCKZBMYHPU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|