C23H30N4O5 — CID 22330051
2-methoxyethyl 3-amino-4-[3-[4-(2-methoxy-2-oxoethyl)piperazin-1-yl]anilino]benzoate (PubChem CID 22330051) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-methoxyethyl 3-amino-4-[3-[4-(2-methoxy-2-oxoethyl)piperazin-1-yl]anilino]benzoate.
| Compound Name | 2-methoxyethyl 3-amino-4-[3-[4-(2-methoxy-2-oxoethyl)piperazin-1-yl]anilino]benzoate |
|---|---|
| PubChem CID | 22330051 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 2-methoxyethyl 3-amino-4-[3-[4-(2-methoxy-2-oxoethyl)piperazin-1-yl]anilino]benzoate |
| SMILES | COCCOC(=O)c1ccc(Nc2cccc(N3CCN(CC(=O)OC)CC3)c2)c(N)c1 |
| InChI | InChI=1S/C23H30N4O5/c1-30-12-13-32-23(29)17-6-7-21(20(24)14-17)25-18-4-3-5-19(15-18)27-10-8-26(9-11-27)16-22(28)31-2/h3-7,14-15,25H,8-13,16,24H2,1-2H3 |
| InChIKey | KSJSRCLVFQTDSF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|