C17H20N2O3 — CID 174422908
methyl 2-[4-[3-(furan-3-yl)phenyl]piperazin-1-yl]acetate (PubChem CID 174422908) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is methyl 2-[4-[3-(furan-3-yl)phenyl]piperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[3-(furan-3-yl)phenyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 174422908 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | methyl 2-[4-[3-(furan-3-yl)phenyl]piperazin-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(c2cccc(-c3ccoc3)c2)CC1 |
| InChI | InChI=1S/C17H20N2O3/c1-21-17(20)12-18-6-8-19(9-7-18)16-4-2-3-14(11-16)15-5-10-22-13-15/h2-5,10-11,13H,6-9,12H2,1H3 |
| InChIKey | RNOZLUZVTSORFT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |