C23H26N4O3 — CID 22330021
ethyl 4-[3-[2-amino-4-(furan-3-yl)anilino]phenyl]piperazine-1-carboxylate (PubChem CID 22330021) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is ethyl 4-[3-[2-amino-4-(furan-3-yl)anilino]phenyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-[2-amino-4-(furan-3-yl)anilino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22330021 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | ethyl 4-[3-[2-amino-4-(furan-3-yl)anilino]phenyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cccc(Nc3ccc(-c4ccoc4)cc3N)c2)CC1 |
| InChI | InChI=1S/C23H26N4O3/c1-2-30-23(28)27-11-9-26(10-12-27)20-5-3-4-19(15-20)25-22-7-6-17(14-21(22)24)18-8-13-29-16-18/h3-8,13-16,25H,2,9-12,24H2,1H3 |
| InChIKey | RXKOECVTPPMLLS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|