C26H28N4O3 — CID 67483581
butyl 4-[3-[5-(furan-3-yl)benzimidazol-1-yl]phenyl]piperazine-1-carboxylate (PubChem CID 67483581) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is butyl 4-[3-[5-(furan-3-yl)benzimidazol-1-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[3-[5-(furan-3-yl)benzimidazol-1-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67483581 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | butyl 4-[3-[5-(furan-3-yl)benzimidazol-1-yl]phenyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(c2cccc(-n3cnc4cc(-c5ccoc5)ccc43)c2)CC1 |
| InChI | InChI=1S/C26H28N4O3/c1-2-3-14-33-26(31)29-12-10-28(11-13-29)22-5-4-6-23(17-22)30-19-27-24-16-20(7-8-25(24)30)21-9-15-32-18-21/h4-9,15-19H,2-3,10-14H2,1H3 |
| InChIKey | BDFDIYZDAYDQPO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 63.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|