C28H37N5O4 — CID 10185746
2-methoxyethyl 1-[3-[4-[2-(diethylamino)-2-oxoethyl]-1,4-diazepan-1-yl]phenyl]benzimidazole-5-carboxylate (PubChem CID 10185746) has the molecular formula C28H37N5O4 and a molecular weight of 507.64 g/mol. Its IUPAC name is 2-methoxyethyl 1-[3-[4-[2-(diethylamino)-2-oxoethyl]-1,4-diazepan-1-yl]phenyl]benzimidazole-5-carboxylate.
| Compound Name | 2-methoxyethyl 1-[3-[4-[2-(diethylamino)-2-oxoethyl]-1,4-diazepan-1-yl]phenyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 10185746 |
| Molecular Formula | C28H37N5O4 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | 2-methoxyethyl 1-[3-[4-[2-(diethylamino)-2-oxoethyl]-1,4-diazepan-1-yl]phenyl]benzimidazole-5-carboxylate |
| SMILES | CCN(CC)C(=O)CN1CCCN(c2cccc(-n3cnc4cc(C(=O)OCCOC)ccc43)c2)CC1 |
| InChI | InChI=1S/C28H37N5O4/c1-4-31(5-2)27(34)20-30-12-7-13-32(15-14-30)23-8-6-9-24(19-23)33-21-29-25-18-22(10-11-26(25)33)28(35)37-17-16-36-3/h6,8-11,18-19,21H,4-5,7,12-17,20H2,1-3H3 |
| InChIKey | SSVWRASLAJQRSC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|