C22H22N4O3 — CID 67484191
ethyl 1-[3-[methoxy-(2-methylpyrazol-3-yl)methyl]phenyl]benzimidazole-5-carboxylate (PubChem CID 67484191) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is ethyl 1-[3-[methoxy-(2-methylpyrazol-3-yl)methyl]phenyl]benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-[3-[methoxy-(2-methylpyrazol-3-yl)methyl]phenyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 67484191 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | ethyl 1-[3-[methoxy-(2-methylpyrazol-3-yl)methyl]phenyl]benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)ncn2-c1cccc(C(OC)c2ccnn2C)c1 |
| InChI | InChI=1S/C22H22N4O3/c1-4-29-22(27)16-8-9-19-18(13-16)23-14-26(19)17-7-5-6-15(12-17)21(28-3)20-10-11-24-25(20)2/h5-14,21H,4H2,1-3H3 |
| InChIKey | IOKULENVKMRQBD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |