C12H12F2N2O2 — CID 152584994
ethyl 1-(2,2-difluoroethyl)benzimidazole-5-carboxylate (PubChem CID 152584994) has the molecular formula C12H12F2N2O2 and a molecular weight of 254.24 g/mol. Its IUPAC name is ethyl 1-(2,2-difluoroethyl)benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-(2,2-difluoroethyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 152584994 |
| Molecular Formula | C12H12F2N2O2 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | ethyl 1-(2,2-difluoroethyl)benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)ncn2CC(F)F |
| InChI | InChI=1S/C12H12F2N2O2/c1-2-18-12(17)8-3-4-10-9(5-8)15-7-16(10)6-11(13)14/h3-5,7,11H,2,6H2,1H3 |
| InChIKey | YUGQWFBLFNWRRN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |