C11H14N4O2 — CID 91811951
ethyl 1-(2-aminoethyl)benzotriazole-5-carboxylate (PubChem CID 91811951) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is ethyl 1-(2-aminoethyl)benzotriazole-5-carboxylate.
| Compound Name | ethyl 1-(2-aminoethyl)benzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 91811951 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | ethyl 1-(2-aminoethyl)benzotriazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nnn2CCN |
| InChI | InChI=1S/C11H14N4O2/c1-2-17-11(16)8-3-4-10-9(7-8)13-14-15(10)6-5-12/h3-4,7H,2,5-6,12H2,1H3 |
| InChIKey | QAONMQNXDCHCQS-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |