C16H13Cl2N3O2 — CID 7806069
(3,4-dichlorophenyl)methyl 1-ethylbenzotriazole-5-carboxylate (PubChem CID 7806069) has the molecular formula C16H13Cl2N3O2 and a molecular weight of 350.21 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 1-ethylbenzotriazole-5-carboxylate.
| Compound Name | (3,4-dichlorophenyl)methyl 1-ethylbenzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 7806069 |
| Molecular Formula | C16H13Cl2N3O2 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 1-ethylbenzotriazole-5-carboxylate |
| SMILES | CCn1nnc2cc(C(=O)OCc3ccc(Cl)c(Cl)c3)ccc21 |
| InChI | InChI=1S/C16H13Cl2N3O2/c1-2-21-15-6-4-11(8-14(15)19-20-21)16(22)23-9-10-3-5-12(17)13(18)7-10/h3-8H,2,9H2,1H3 |
| InChIKey | WHJZPFVZVQZHHI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |