C19H19FN4O3 — CID 7805737
[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 1-ethylbenzotriazole-5-carboxylate (PubChem CID 7805737) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 1-ethylbenzotriazole-5-carboxylate.
| Compound Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 1-ethylbenzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 7805737 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 1-ethylbenzotriazole-5-carboxylate |
| SMILES | CCn1nnc2cc(C(=O)OCC(=O)NCCc3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C19H19FN4O3/c1-2-24-17-8-5-14(11-16(17)22-23-24)19(26)27-12-18(25)21-10-9-13-3-6-15(20)7-4-13/h3-8,11H,2,9-10,12H2,1H3,(H,21,25) |
| InChIKey | GFBHFNAPDVYFIJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |