C20H22N4O4 — CID 7806112
[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 1-ethylbenzotriazole-5-carboxylate (PubChem CID 7806112) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 1-ethylbenzotriazole-5-carboxylate.
| Compound Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 1-ethylbenzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 7806112 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 1-ethylbenzotriazole-5-carboxylate |
| SMILES | CCn1nnc2cc(C(=O)OCC(=O)NCCc3ccc(OC)cc3)ccc21 |
| InChI | InChI=1S/C20H22N4O4/c1-3-24-18-9-6-15(12-17(18)22-23-24)20(26)28-13-19(25)21-11-10-14-4-7-16(27-2)8-5-14/h4-9,12H,3,10-11,13H2,1-2H3,(H,21,25) |
| InChIKey | ZNBJMPQVPPUNAU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |