C18H17ClN4O3 — CID 7805763
[2-(4-chloro-2-methylanilino)-2-oxoethyl] 1-ethylbenzotriazole-5-carboxylate (PubChem CID 7805763) has the molecular formula C18H17ClN4O3 and a molecular weight of 372.81 g/mol. Its IUPAC name is [2-(4-chloro-2-methylanilino)-2-oxoethyl] 1-ethylbenzotriazole-5-carboxylate.
| Compound Name | [2-(4-chloro-2-methylanilino)-2-oxoethyl] 1-ethylbenzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 7805763 |
| Molecular Formula | C18H17ClN4O3 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | [2-(4-chloro-2-methylanilino)-2-oxoethyl] 1-ethylbenzotriazole-5-carboxylate |
| SMILES | CCn1nnc2cc(C(=O)OCC(=O)Nc3ccc(Cl)cc3C)ccc21 |
| InChI | InChI=1S/C18H17ClN4O3/c1-3-23-16-7-4-12(9-15(16)21-22-23)18(25)26-10-17(24)20-14-6-5-13(19)8-11(14)2/h4-9H,3,10H2,1-2H3,(H,20,24) |
| InChIKey | BJFJVBHJDDPSQX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |