cyanomethyl 1-ethylbenzotriazole-5-carboxylate

C11H10N4O2 — CID 7806064

IUPACcyanomethyl 1-ethylbenzotriazole-5-carboxylate
SMILESCCn1nnc2cc(C(=O)OCC#N)ccc21
InChIInChI=1S/C11H10N4O2/c1-2-15-10-4-3-8(7-9(10)13-14-15)11(16)17-6-5-12/h3-4,7H,2,6H2,1H3
InChIKeyWRVKACJERYCJKG-UHFFFAOYSA-N
MW230.23 g/mol
LogP1.13
Rot. Bonds3

About cyanomethyl 1-ethylbenzotriazole-5-carboxylate

cyanomethyl 1-ethylbenzotriazole-5-carboxylate (PubChem CID 7806064) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is cyanomethyl 1-ethylbenzotriazole-5-carboxylate.

Molecular Properties

Compound Namecyanomethyl 1-ethylbenzotriazole-5-carboxylate
PubChem CID7806064
Molecular FormulaC11H10N4O2
Molecular Weight230.23 g/mol
Exact Mass230.08
IUPAC Namecyanomethyl 1-ethylbenzotriazole-5-carboxylate
SMILESCCn1nnc2cc(C(=O)OCC#N)ccc21
InChIInChI=1S/C11H10N4O2/c1-2-15-10-4-3-8(7-9(10)13-14-15)11(16)17-6-5-12/h3-4,7H,2,6H2,1H3
InChIKeyWRVKACJERYCJKG-UHFFFAOYSA-N
XLogP1.13
TPSA80.80 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.23
LogP ≤ 51.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze cyanomethyl 1-ethylbenzotriazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyanomethyl 1-ethylbenzotriazole-5-carboxylate?
The IUPAC name of cyanomethyl 1-ethylbenzotriazole-5-carboxylate (CID 7806064) is cyanomethyl 1-ethylbenzotriazole-5-carboxylate.
What is the SMILES notation for cyanomethyl 1-ethylbenzotriazole-5-carboxylate?
The canonical SMILES for cyanomethyl 1-ethylbenzotriazole-5-carboxylate is CCn1nnc2cc(C(=O)OCC#N)ccc21.
What is the InChIKey of cyanomethyl 1-ethylbenzotriazole-5-carboxylate?
The InChIKey is WRVKACJERYCJKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O2/c1-2-15-10-4-3-8(7-9(10)13-14-15)11(16)17-6-5-12/h3-4,7H,2,6H2,1H3.
What are the key properties of cyanomethyl 1-ethylbenzotriazole-5-carboxylate?
cyanomethyl 1-ethylbenzotriazole-5-carboxylate has a molecular weight of 230.23 g/mol, XLogP of 1.13, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl 1-ethylbenzotriazole-5-carboxylate is sourced from PubChem (CID 7806064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).