C16H15FN4O — CID 53111432
N-ethyl-1-[(4-fluorophenyl)methyl]benzotriazole-5-carboxamide (PubChem CID 53111432) has the molecular formula C16H15FN4O and a molecular weight of 298.32 g/mol. Its IUPAC name is N-ethyl-1-[(4-fluorophenyl)methyl]benzotriazole-5-carboxamide.
| Compound Name | N-ethyl-1-[(4-fluorophenyl)methyl]benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 53111432 |
| Molecular Formula | C16H15FN4O |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N-ethyl-1-[(4-fluorophenyl)methyl]benzotriazole-5-carboxamide |
| SMILES | CCNC(=O)c1ccc2c(c1)nnn2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN4O/c1-2-18-16(22)12-5-8-15-14(9-12)19-20-21(15)10-11-3-6-13(17)7-4-11/h3-9H,2,10H2,1H3,(H,18,22) |
| InChIKey | AYGRGRHRDBWAAD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |