C23H19FN4O3 — CID 53111407
ethyl 3-[[1-[(4-fluorophenyl)methyl]benzotriazole-5-carbonyl]amino]benzoate (PubChem CID 53111407) has the molecular formula C23H19FN4O3 and a molecular weight of 418.43 g/mol. Its IUPAC name is ethyl 3-[[1-[(4-fluorophenyl)methyl]benzotriazole-5-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-[[1-[(4-fluorophenyl)methyl]benzotriazole-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 53111407 |
| Molecular Formula | C23H19FN4O3 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | ethyl 3-[[1-[(4-fluorophenyl)methyl]benzotriazole-5-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)c2ccc3c(c2)nnn3Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H19FN4O3/c1-2-31-23(30)17-4-3-5-19(12-17)25-22(29)16-8-11-21-20(13-16)26-27-28(21)14-15-6-9-18(24)10-7-15/h3-13H,2,14H2,1H3,(H,25,29) |
| InChIKey | PZLAKCZAOMDHLB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |