C21H25FN4O3 — CID 20600761
ethyl 4-[3-(4-acetylpiperazin-1-yl)anilino]-5-amino-2-fluorobenzoate (PubChem CID 20600761) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is ethyl 4-[3-(4-acetylpiperazin-1-yl)anilino]-5-amino-2-fluorobenzoate.
| Compound Name | ethyl 4-[3-(4-acetylpiperazin-1-yl)anilino]-5-amino-2-fluorobenzoate |
|---|---|
| PubChem CID | 20600761 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | ethyl 4-[3-(4-acetylpiperazin-1-yl)anilino]-5-amino-2-fluorobenzoate |
| SMILES | CCOC(=O)c1cc(N)c(Nc2cccc(N3CCN(C(C)=O)CC3)c2)cc1F |
| InChI | InChI=1S/C21H25FN4O3/c1-3-29-21(28)17-12-19(23)20(13-18(17)22)24-15-5-4-6-16(11-15)26-9-7-25(8-10-26)14(2)27/h4-6,11-13,24H,3,7-10,23H2,1-2H3 |
| InChIKey | DEWCLUIDCIXTNW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|