C23H30N4O5 — CID 54241594
3-amino-2-(2-methoxyethyl)-4-[3-[4-(2-methoxy-2-oxoethyl)piperazin-1-yl]anilino]benzoic acid (PubChem CID 54241594) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-amino-2-(2-methoxyethyl)-4-[3-[4-(2-methoxy-2-oxoethyl)piperazin-1-yl]anilino]benzoic acid.
| Compound Name | 3-amino-2-(2-methoxyethyl)-4-[3-[4-(2-methoxy-2-oxoethyl)piperazin-1-yl]anilino]benzoic acid |
|---|---|
| PubChem CID | 54241594 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 3-amino-2-(2-methoxyethyl)-4-[3-[4-(2-methoxy-2-oxoethyl)piperazin-1-yl]anilino]benzoic acid |
| SMILES | COCCc1c(C(=O)O)ccc(Nc2cccc(N3CCN(CC(=O)OC)CC3)c2)c1N |
| InChI | InChI=1S/C23H30N4O5/c1-31-13-8-18-19(23(29)30)6-7-20(22(18)24)25-16-4-3-5-17(14-16)27-11-9-26(10-12-27)15-21(28)32-2/h3-7,14,25H,8-13,15,24H2,1-2H3,(H,29,30) |
| InChIKey | QQJUYESGXKCPPW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|