C19H27N3O — CID 112722071
3-(furan-2-yl)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]propan-1-amine (PubChem CID 112722071) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]propan-1-amine.
| Compound Name | 3-(furan-2-yl)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 112722071 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 3-(furan-2-yl)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]propan-1-amine |
| SMILES | CN1CCN(c2ccc(CNCCCc3ccco3)cc2)CC1 |
| InChI | InChI=1S/C19H27N3O/c1-21-11-13-22(14-12-21)18-8-6-17(7-9-18)16-20-10-2-4-19-5-3-15-23-19/h3,5-9,15,20H,2,4,10-14,16H2,1H3 |
| InChIKey | FXGPMUGHVNJQNF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|