C20H23ClN6O2S — CID 118559397
4-[3-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]propylamino]benzenesulfonamide (PubChem CID 118559397) has the molecular formula C20H23ClN6O2S and a molecular weight of 446.96 g/mol. Its IUPAC name is 4-[3-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]propylamino]benzenesulfonamide.
| Compound Name | 4-[3-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]propylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 118559397 |
| Molecular Formula | C20H23ClN6O2S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 4-[3-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]propylamino]benzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1-c1cc(NCCCNc2ccc(S(N)(=O)=O)cc2)nc(N)n1 |
| InChI | InChI=1S/C20H23ClN6O2S/c1-13-16(4-2-5-17(13)21)18-12-19(27-20(22)26-18)25-11-3-10-24-14-6-8-15(9-7-14)30(23,28)29/h2,4-9,12,24H,3,10-11H2,1H3,(H2,23,28,29)(H3,22,25,26,27) |
| InChIKey | NRSPGDWJQAUNNW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|