C19H19ClN4O3 — CID 118559241
5-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethyl]benzene-1,2,3-triol (PubChem CID 118559241) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is 5-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethyl]benzene-1,2,3-triol.
| Compound Name | 5-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 118559241 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 5-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethyl]benzene-1,2,3-triol |
| SMILES | Cc1c(Cl)cccc1-c1cc(NCCc2cc(O)c(O)c(O)c2)nc(N)n1 |
| InChI | InChI=1S/C19H19ClN4O3/c1-10-12(3-2-4-13(10)20)14-9-17(24-19(21)23-14)22-6-5-11-7-15(25)18(27)16(26)8-11/h2-4,7-9,25-27H,5-6H2,1H3,(H3,21,22,23,24) |
| InChIKey | OIUXGLTZWWKOJD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|