C20H23ClN6O — CID 118567910
N-[amino-[4-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethyl]phenyl]methyl]hydroxylamine (PubChem CID 118567910) has the molecular formula C20H23ClN6O and a molecular weight of 398.90 g/mol. Its IUPAC name is N-[amino-[4-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethyl]phenyl]methyl]hydroxylamine.
| Compound Name | N-[amino-[4-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethyl]phenyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 118567910 |
| Molecular Formula | C20H23ClN6O |
| Molecular Weight | 398.90 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-[amino-[4-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethyl]phenyl]methyl]hydroxylamine |
| SMILES | Cc1c(Cl)cccc1-c1cc(NCCc2ccc(C(N)NO)cc2)nc(N)n1 |
| InChI | InChI=1S/C20H23ClN6O/c1-12-15(3-2-4-16(12)21)17-11-18(26-20(23)25-17)24-10-9-13-5-7-14(8-6-13)19(22)27-28/h2-8,11,19,27-28H,9-10,22H2,1H3,(H3,23,24,25,26) |
| InChIKey | OGIGYUUSGGCVEW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.90 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|