C21H23ClN6O — CID 118559339
4-[3-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]propylamino]benzamide (PubChem CID 118559339) has the molecular formula C21H23ClN6O and a molecular weight of 410.91 g/mol. Its IUPAC name is 4-[3-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]propylamino]benzamide.
| Compound Name | 4-[3-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]propylamino]benzamide |
|---|---|
| PubChem CID | 118559339 |
| Molecular Formula | C21H23ClN6O |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-[3-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]propylamino]benzamide |
| SMILES | Cc1c(Cl)cccc1-c1cc(NCCCNc2ccc(C(N)=O)cc2)nc(N)n1 |
| InChI | InChI=1S/C21H23ClN6O/c1-13-16(4-2-5-17(13)22)18-12-19(28-21(24)27-18)26-11-3-10-25-15-8-6-14(7-9-15)20(23)29/h2,4-9,12,25H,3,10-11H2,1H3,(H2,23,29)(H3,24,26,27,28) |
| InChIKey | YRGLGUNKHNSPDN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|