C21H25ClN6O2S — CID 118559448
4-[3-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]propylamino]-N-methylbenzenesulfonamide (PubChem CID 118559448) has the molecular formula C21H25ClN6O2S and a molecular weight of 460.99 g/mol. Its IUPAC name is 4-[3-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]propylamino]-N-methylbenzenesulfonamide.
| Compound Name | 4-[3-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]propylamino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 118559448 |
| Molecular Formula | C21H25ClN6O2S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 4-[3-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]propylamino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCCCNc2cc(-c3cccc(Cl)c3C)nc(N)n2)cc1 |
| InChI | InChI=1S/C21H25ClN6O2S/c1-14-17(5-3-6-18(14)22)19-13-20(28-21(23)27-19)26-12-4-11-25-15-7-9-16(10-8-15)31(29,30)24-2/h3,5-10,13,24-25H,4,11-12H2,1-2H3,(H3,23,26,27,28) |
| InChIKey | TYHYHYNTZFDDDQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|