C19H20ClN5O3S — CID 130209364
6-(3-chloro-2-methylphenyl)-4-N-[2-[(6-methylsulfonyl-3-pyridinyl)oxy]ethyl]pyrimidine-2,4-diamine (PubChem CID 130209364) has the molecular formula C19H20ClN5O3S and a molecular weight of 433.92 g/mol. Its IUPAC name is 6-(3-chloro-2-methylphenyl)-4-N-[2-[(6-methylsulfonyl-3-pyridinyl)oxy]ethyl]pyrimidine-2,4-diamine.
| Compound Name | 6-(3-chloro-2-methylphenyl)-4-N-[2-[(6-methylsulfonyl-3-pyridinyl)oxy]ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 130209364 |
| Molecular Formula | C19H20ClN5O3S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 6-(3-chloro-2-methylphenyl)-4-N-[2-[(6-methylsulfonyl-3-pyridinyl)oxy]ethyl]pyrimidine-2,4-diamine |
| SMILES | Cc1c(Cl)cccc1-c1cc(NCCOc2ccc(S(C)(=O)=O)nc2)nc(N)n1 |
| InChI | InChI=1S/C19H20ClN5O3S/c1-12-14(4-3-5-15(12)20)16-10-17(25-19(21)24-16)22-8-9-28-13-6-7-18(23-11-13)29(2,26)27/h3-7,10-11H,8-9H2,1-2H3,(H3,21,22,24,25) |
| InChIKey | KEKQHMFEBXLOLW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|