C20H22ClN7O — CID 118568110
N'-amino-4-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethoxy]benzenecarboximidamide (PubChem CID 118568110) has the molecular formula C20H22ClN7O and a molecular weight of 411.90 g/mol. Its IUPAC name is N'-amino-4-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethoxy]benzenecarboximidamide.
| Compound Name | N'-amino-4-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 118568110 |
| Molecular Formula | C20H22ClN7O |
| Molecular Weight | 411.90 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N'-amino-4-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethoxy]benzenecarboximidamide |
| SMILES | Cc1c(Cl)cccc1-c1cc(NCCOc2ccc(/C(N)=N/N)cc2)nc(N)n1 |
| InChI | InChI=1S/C20H22ClN7O/c1-12-15(3-2-4-16(12)21)17-11-18(27-20(23)26-17)25-9-10-29-14-7-5-13(6-8-14)19(22)28-24/h2-8,11H,9-10,24H2,1H3,(H2,22,28)(H3,23,25,26,27) |
| InChIKey | CTLKXZPOUZIXRR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.90 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|