C21H26N8 — CID 130219168
N'-amino-4-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]benzenecarboximidamide (PubChem CID 130219168) has the molecular formula C21H26N8 and a molecular weight of 390.50 g/mol. Its IUPAC name is N'-amino-4-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]benzenecarboximidamide.
| Compound Name | N'-amino-4-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 130219168 |
| Molecular Formula | C21H26N8 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N'-amino-4-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]benzenecarboximidamide |
| SMILES | Cc1cccc(-c2cc(NCCNc3ccc(/C(N)=N/N)cc3)nc(N)n2)c1C |
| InChI | InChI=1S/C21H26N8/c1-13-4-3-5-17(14(13)2)18-12-19(28-21(23)27-18)26-11-10-25-16-8-6-15(7-9-16)20(22)29-24/h3-9,12,25H,10-11,24H2,1-2H3,(H2,22,29)(H3,23,26,27,28) |
| InChIKey | DQWCDTHBSMVCFE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|