C21H25N7O2 — CID 118559487
methyl 2-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]-6-methylpyrimidine-4-carboxylate (PubChem CID 118559487) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is methyl 2-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]-6-methylpyrimidine-4-carboxylate.
| Compound Name | methyl 2-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]-6-methylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 118559487 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | methyl 2-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]-6-methylpyrimidine-4-carboxylate |
| SMILES | COC(=O)c1cc(C)nc(NCCNc2cc(-c3cccc(C)c3C)nc(N)n2)n1 |
| InChI | InChI=1S/C21H25N7O2/c1-12-6-5-7-15(14(12)3)16-11-18(28-20(22)26-16)23-8-9-24-21-25-13(2)10-17(27-21)19(29)30-4/h5-7,10-11H,8-9H2,1-4H3,(H,24,25,27)(H3,22,23,26,28) |
| InChIKey | BVACMPYUIYYQFH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|