C21H24N6O2 — CID 159732619
methyl 5-[3-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]propyl]pyrazine-2-carboxylate (PubChem CID 159732619) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is methyl 5-[3-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]propyl]pyrazine-2-carboxylate.
| Compound Name | methyl 5-[3-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]propyl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 159732619 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | methyl 5-[3-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]propyl]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(CCCNc2cc(-c3cccc(C)c3C)nc(N)n2)cn1 |
| InChI | InChI=1S/C21H24N6O2/c1-13-6-4-8-16(14(13)2)17-10-19(27-21(22)26-17)23-9-5-7-15-11-25-18(12-24-15)20(28)29-3/h4,6,8,10-12H,5,7,9H2,1-3H3,(H3,22,23,26,27) |
| InChIKey | HIIFQPBXXGQFSF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|