C22H26N6O2 — CID 118559255
ethyl 6-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]pyridine-3-carboxylate (PubChem CID 118559255) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is ethyl 6-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 118559255 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | ethyl 6-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NCCNc2cc(-c3cccc(C)c3C)nc(N)n2)nc1 |
| InChI | InChI=1S/C22H26N6O2/c1-4-30-21(29)16-8-9-19(26-13-16)24-10-11-25-20-12-18(27-22(23)28-20)17-7-5-6-14(2)15(17)3/h5-9,12-13H,4,10-11H2,1-3H3,(H,24,26)(H3,23,25,27,28) |
| InChIKey | NZUSRXGVMZQPAD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|