C22H26N4O4S2 — CID 158404237
6-(2,3-dimethylphenyl)-4-N-[3-(4-methylsulfonylphenyl)sulfonylpropyl]pyrimidine-2,4-diamine (PubChem CID 158404237) has the molecular formula C22H26N4O4S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 6-(2,3-dimethylphenyl)-4-N-[3-(4-methylsulfonylphenyl)sulfonylpropyl]pyrimidine-2,4-diamine.
| Compound Name | 6-(2,3-dimethylphenyl)-4-N-[3-(4-methylsulfonylphenyl)sulfonylpropyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 158404237 |
| Molecular Formula | C22H26N4O4S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 6-(2,3-dimethylphenyl)-4-N-[3-(4-methylsulfonylphenyl)sulfonylpropyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cccc(-c2cc(NCCCS(=O)(=O)c3ccc(S(C)(=O)=O)cc3)nc(N)n2)c1C |
| InChI | InChI=1S/C22H26N4O4S2/c1-15-6-4-7-19(16(15)2)20-14-21(26-22(23)25-20)24-12-5-13-32(29,30)18-10-8-17(9-11-18)31(3,27)28/h4,6-11,14H,5,12-13H2,1-3H3,(H3,23,24,25,26) |
| InChIKey | VLZAFCKVGMTVDM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|