C21H25N5O4S2 — CID 118636875
N-[3-[[2-amino-6-(2-methylphenyl)pyrimidin-4-yl]amino]propyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 118636875) has the molecular formula C21H25N5O4S2 and a molecular weight of 475.60 g/mol. Its IUPAC name is N-[3-[[2-amino-6-(2-methylphenyl)pyrimidin-4-yl]amino]propyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[3-[[2-amino-6-(2-methylphenyl)pyrimidin-4-yl]amino]propyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 118636875 |
| Molecular Formula | C21H25N5O4S2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | N-[3-[[2-amino-6-(2-methylphenyl)pyrimidin-4-yl]amino]propyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | Cc1ccccc1-c1cc(NCCCNS(=O)(=O)c2ccc(S(C)(=O)=O)cc2)nc(N)n1 |
| InChI | InChI=1S/C21H25N5O4S2/c1-15-6-3-4-7-18(15)19-14-20(26-21(22)25-19)23-12-5-13-24-32(29,30)17-10-8-16(9-11-17)31(2,27)28/h3-4,6-11,14,24H,5,12-13H2,1-2H3,(H3,22,23,25,26) |
| InChIKey | XXDRDHHJTFCCIH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|