C21H25N5S — CID 155440732
6-(2,3-dimethylphenyl)-4-N-[3-(phenylsulfanylamino)propyl]pyrimidine-2,4-diamine (PubChem CID 155440732) has the molecular formula C21H25N5S and a molecular weight of 379.53 g/mol. Its IUPAC name is 6-(2,3-dimethylphenyl)-4-N-[3-(phenylsulfanylamino)propyl]pyrimidine-2,4-diamine.
| Compound Name | 6-(2,3-dimethylphenyl)-4-N-[3-(phenylsulfanylamino)propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155440732 |
| Molecular Formula | C21H25N5S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 6-(2,3-dimethylphenyl)-4-N-[3-(phenylsulfanylamino)propyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cccc(-c2cc(NCCCNSc3ccccc3)nc(N)n2)c1C |
| InChI | InChI=1S/C21H25N5S/c1-15-8-6-11-18(16(15)2)19-14-20(26-21(22)25-19)23-12-7-13-24-27-17-9-4-3-5-10-17/h3-6,8-11,14,24H,7,12-13H2,1-2H3,(H3,22,23,25,26) |
| InChIKey | WOVUGDVXPISJJE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|