C18H17ClN6O3 — CID 118559418
2-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethoxy]pyrimidine-4-carboxylic acid (PubChem CID 118559418) has the molecular formula C18H17ClN6O3 and a molecular weight of 400.83 g/mol. Its IUPAC name is 2-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethoxy]pyrimidine-4-carboxylic acid.
| Compound Name | 2-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethoxy]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 118559418 |
| Molecular Formula | C18H17ClN6O3 |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-[2-[[2-amino-6-(3-chloro-2-methylphenyl)pyrimidin-4-yl]amino]ethoxy]pyrimidine-4-carboxylic acid |
| SMILES | Cc1c(Cl)cccc1-c1cc(NCCOc2nccc(C(=O)O)n2)nc(N)n1 |
| InChI | InChI=1S/C18H17ClN6O3/c1-10-11(3-2-4-12(10)19)14-9-15(25-17(20)23-14)21-7-8-28-18-22-6-5-13(24-18)16(26)27/h2-6,9H,7-8H2,1H3,(H,26,27)(H3,20,21,23,25) |
| InChIKey | FJYDVBSQPULDHZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 136.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|