C12H18BrFN2O — CID 107532489
3-[4-(aminomethyl)-3-bromo-N-ethyl-2-fluoroanilino]propan-1-ol (PubChem CID 107532489) has the molecular formula C12H18BrFN2O and a molecular weight of 305.19 g/mol. Its IUPAC name is 3-[4-(aminomethyl)-3-bromo-N-ethyl-2-fluoroanilino]propan-1-ol.
| Compound Name | 3-[4-(aminomethyl)-3-bromo-N-ethyl-2-fluoroanilino]propan-1-ol |
|---|---|
| PubChem CID | 107532489 |
| Molecular Formula | C12H18BrFN2O |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-[4-(aminomethyl)-3-bromo-N-ethyl-2-fluoroanilino]propan-1-ol |
| SMILES | CCN(CCCO)c1ccc(CN)c(Br)c1F |
| InChI | InChI=1S/C12H18BrFN2O/c1-2-16(6-3-7-17)10-5-4-9(8-15)11(13)12(10)14/h4-5,17H,2-3,6-8,15H2,1H3 |
| InChIKey | YMZCPBDLLFEKTK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |