C12H15F3N2O2S — CID 43648523
1-N-(1,1-dioxothiolan-3-yl)-1-N-methyl-4-(trifluoromethyl)benzene-1,2-diamine (PubChem CID 43648523) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.32 g/mol. Its IUPAC name is 1-N-(1,1-dioxothiolan-3-yl)-1-N-methyl-4-(trifluoromethyl)benzene-1,2-diamine.
| Compound Name | 1-N-(1,1-dioxothiolan-3-yl)-1-N-methyl-4-(trifluoromethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 43648523 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-N-(1,1-dioxothiolan-3-yl)-1-N-methyl-4-(trifluoromethyl)benzene-1,2-diamine |
| SMILES | CN(c1ccc(C(F)(F)F)cc1N)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15F3N2O2S/c1-17(9-4-5-20(18,19)7-9)11-3-2-8(6-10(11)16)12(13,14)15/h2-3,6,9H,4-5,7,16H2,1H3 |
| InChIKey | OJDUJHDLVIYQNV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|