C12H17FN2O3S — CID 63599419
1-N-(1,1-dioxothiolan-3-yl)-4-fluoro-5-methoxy-1-N-methylbenzene-1,2-diamine (PubChem CID 63599419) has the molecular formula C12H17FN2O3S and a molecular weight of 288.34 g/mol. Its IUPAC name is 1-N-(1,1-dioxothiolan-3-yl)-4-fluoro-5-methoxy-1-N-methylbenzene-1,2-diamine.
| Compound Name | 1-N-(1,1-dioxothiolan-3-yl)-4-fluoro-5-methoxy-1-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 63599419 |
| Molecular Formula | C12H17FN2O3S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-N-(1,1-dioxothiolan-3-yl)-4-fluoro-5-methoxy-1-N-methylbenzene-1,2-diamine |
| SMILES | COc1cc(N(C)C2CCS(=O)(=O)C2)c(N)cc1F |
| InChI | InChI=1S/C12H17FN2O3S/c1-15(8-3-4-19(16,17)7-8)11-6-12(18-2)9(13)5-10(11)14/h5-6,8H,3-4,7,14H2,1-2H3 |
| InChIKey | SOKIPYDZFPDBPS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|